C27H54NO8P — CID 163360586
[(2R)-3-decanoyloxy-2-nonanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 163360586) has the molecular formula C27H54NO8P and a molecular weight of 551.70 g/mol. Its IUPAC name is [(2R)-3-decanoyloxy-2-nonanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-decanoyloxy-2-nonanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 163360586 |
| Molecular Formula | C27H54NO8P |
| Molecular Weight | 551.70 g/mol |
| Exact Mass | 551.36 |
| IUPAC Name | [(2R)-3-decanoyloxy-2-nonanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC |
| InChI | InChI=1S/C27H54NO8P/c1-6-8-10-12-14-16-17-19-26(29)33-23-25(36-27(30)20-18-15-13-11-9-7-2)24-35-37(31,32)34-22-21-28(3,4)5/h25H,6-24H2,1-5H3/t25-/m1/s1 |
| InChIKey | LVYXXJCETQJDMS-RUZDIDTESA-N |
| XLogP | 5.54 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.70 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|