C25H24ClNO — CID 163360592
(E)-2-(4-chlorophenyl)-2-cyclopropyl-N-[(2-methyl-3-phenylphenyl)methoxy]ethenamine (PubChem CID 163360592) has the molecular formula C25H24ClNO and a molecular weight of 389.93 g/mol. Its IUPAC name is (E)-2-(4-chlorophenyl)-2-cyclopropyl-N-[(2-methyl-3-phenylphenyl)methoxy]ethenamine.
| Compound Name | (E)-2-(4-chlorophenyl)-2-cyclopropyl-N-[(2-methyl-3-phenylphenyl)methoxy]ethenamine |
|---|---|
| PubChem CID | 163360592 |
| Molecular Formula | C25H24ClNO |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | (E)-2-(4-chlorophenyl)-2-cyclopropyl-N-[(2-methyl-3-phenylphenyl)methoxy]ethenamine |
| SMILES | Cc1c(CON/C=C(/c2ccc(Cl)cc2)C2CC2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C25H24ClNO/c1-18-22(8-5-9-24(18)19-6-3-2-4-7-19)17-28-27-16-25(20-10-11-20)21-12-14-23(26)15-13-21/h2-9,12-16,20,27H,10-11,17H2,1H3/b25-16+ |
| InChIKey | SKQNGRQYDKNENW-PCLIKHOPSA-N |
| XLogP | 6.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|