About methyl 7-[(4-hydroxyphenyl)methylamino]-1,3-dimethyl-2-oxido-5,8-dioxoisoquinolin-2-ium-4-carboxylate
methyl 7-[(4-hydroxyphenyl)methylamino]-1,3-dimethyl-2-oxido-5,8-dioxoisoquinolin-2-ium-4-carboxylate (PubChem CID 163360818) has the molecular formula C20H18N2O6
and a molecular weight of 382.37 g/mol. Its IUPAC name is methyl 7-[(4-hydroxyphenyl)methylamino]-1,3-dimethyl-2-oxido-5,8-dioxoisoquinolin-2-ium-4-carboxylate.
Molecular Properties
| Compound Name | methyl 7-[(4-hydroxyphenyl)methylamino]-1,3-dimethyl-2-oxido-5,8-dioxoisoquinolin-2-ium-4-carboxylate |
| PubChem CID | 163360818 |
| Molecular Formula | C20H18N2O6 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | methyl 7-[(4-hydroxyphenyl)methylamino]-1,3-dimethyl-2-oxido-5,8-dioxoisoquinolin-2-ium-4-carboxylate |
| SMILES | COC(=O)c1c2c(c(C)[n+]([O-])c1C)C(=O)C(NCc1ccc(O)cc1)=CC2=O |
| InChI | InChI=1S/C20H18N2O6/c1-10-16-18(17(20(26)28-3)11(2)22(10)27)15(24)8-14(19(16)25)21-9-12-4-6-13(23)7-5-12/h4-8,21,23H,9H2,1-3H3 |
| InChIKey | VGEBMFATVOEGGK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[(4-hydroxyphenyl)methylamino]-1,3-dimethyl-2-oxido-5,8-dioxoisoquinolin-2-ium-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[(4-hydroxyphenyl)methylamino]-1,3-dimethyl-2-oxido-5,8-dioxoisoquinolin-2-ium-4-carboxylate?
The IUPAC name of methyl 7-[(4-hydroxyphenyl)methylamino]-1,3-dimethyl-2-oxido-5,8-dioxoisoquinolin-2-ium-4-carboxylate (CID 163360818) is methyl 7-[(4-hydroxyphenyl)methylamino]-1,3-dimethyl-2-oxido-5,8-dioxoisoquinolin-2-ium-4-carboxylate.
What is the SMILES notation for methyl 7-[(4-hydroxyphenyl)methylamino]-1,3-dimethyl-2-oxido-5,8-dioxoisoquinolin-2-ium-4-carboxylate?
The canonical SMILES for methyl 7-[(4-hydroxyphenyl)methylamino]-1,3-dimethyl-2-oxido-5,8-dioxoisoquinolin-2-ium-4-carboxylate is COC(=O)c1c2c(c(C)[n+]([O-])c1C)C(=O)C(NCc1ccc(O)cc1)=CC2=O.
What is the InChIKey of methyl 7-[(4-hydroxyphenyl)methylamino]-1,3-dimethyl-2-oxido-5,8-dioxoisoquinolin-2-ium-4-carboxylate?
The InChIKey is VGEBMFATVOEGGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O6/c1-10-16-18(17(20(26)28-3)11(2)22(10)27)15(24)8-14(19(16)25)21-9-12-4-6-13(23)7-5-12/h4-8,21,23H,9H2,1-3H3.
What are the key properties of methyl 7-[(4-hydroxyphenyl)methylamino]-1,3-dimethyl-2-oxido-5,8-dioxoisoquinolin-2-ium-4-carboxylate?
methyl 7-[(4-hydroxyphenyl)methylamino]-1,3-dimethyl-2-oxido-5,8-dioxoisoquinolin-2-ium-4-carboxylate has a molecular weight of 382.37 g/mol, XLogP of 1.48, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[(4-hydroxyphenyl)methylamino]-1,3-dimethyl-2-oxido-5,8-dioxoisoquinolin-2-ium-4-carboxylate is sourced from PubChem (CID 163360818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).