C22H32F3N5O4 — CID 163362014
(2S,4S)-N-[(1S)-1-cyano-2-[(3S)-2-oxopyrrolidin-3-yl]ethyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4-methylpiperidine-2-carboxamide (PubChem CID 163362014) has the molecular formula C22H32F3N5O4 and a molecular weight of 487.52 g/mol. Its IUPAC name is (2S,4S)-N-[(1S)-1-cyano-2-[(3S)-2-oxopyrrolidin-3-yl]ethyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4-methylpiperidine-2-carboxamide.
| Compound Name | (2S,4S)-N-[(1S)-1-cyano-2-[(3S)-2-oxopyrrolidin-3-yl]ethyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 163362014 |
| Molecular Formula | C22H32F3N5O4 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | (2S,4S)-N-[(1S)-1-cyano-2-[(3S)-2-oxopyrrolidin-3-yl]ethyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4-methylpiperidine-2-carboxamide |
| SMILES | C[C@H]1CCN(C(=O)[C@@H](NC(=O)C(F)(F)F)C(C)(C)C)[C@H](C(=O)N[C@H](C#N)C[C@@H]2CCNC2=O)C1 |
| InChI | InChI=1S/C22H32F3N5O4/c1-12-6-8-30(19(33)16(21(2,3)4)29-20(34)22(23,24)25)15(9-12)18(32)28-14(11-26)10-13-5-7-27-17(13)31/h12-16H,5-10H2,1-4H3,(H,27,31)(H,28,32)(H,29,34)/t12-,13-,14-,15-,16+/m0/s1 |
| InChIKey | REFKIAYUYFUWJD-UVPYHEFZSA-N |
| XLogP | 1.24 |
| TPSA | 131.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |