C8H2Cl3F5 — CID 163362106
1,2,3,4,5-pentafluoro-6-(1,2,2-trichloroethyl)benzene (PubChem CID 163362106) has the molecular formula C8H2Cl3F5 and a molecular weight of 299.45 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(1,2,2-trichloroethyl)benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(1,2,2-trichloroethyl)benzene |
|---|---|
| PubChem CID | 163362106 |
| Molecular Formula | C8H2Cl3F5 |
| Molecular Weight | 299.45 g/mol |
| Exact Mass | 297.91 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(1,2,2-trichloroethyl)benzene |
| SMILES | Fc1c(F)c(F)c(C(Cl)C(Cl)Cl)c(F)c1F |
| InChI | InChI=1S/C8H2Cl3F5/c9-2(8(10)11)1-3(12)5(14)7(16)6(15)4(1)13/h2,8H |
| InChIKey | HHCKRMRXTLKXEG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|