C27H21N5S — CID 163362465
5-(1-methylindazol-6-yl)-10-[4-(pyrrol-1-ylmethyl)phenyl]-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene (PubChem CID 163362465) has the molecular formula C27H21N5S and a molecular weight of 447.57 g/mol. Its IUPAC name is 5-(1-methylindazol-6-yl)-10-[4-(pyrrol-1-ylmethyl)phenyl]-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene.
| Compound Name | 5-(1-methylindazol-6-yl)-10-[4-(pyrrol-1-ylmethyl)phenyl]-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene |
|---|---|
| PubChem CID | 163362465 |
| Molecular Formula | C27H21N5S |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 5-(1-methylindazol-6-yl)-10-[4-(pyrrol-1-ylmethyl)phenyl]-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene |
| SMILES | Cn1ncc2ccc(-c3n[nH]c4c3Cc3sc(-c5ccc(Cn6cccc6)cc5)cc3-4)cc21 |
| InChI | InChI=1S/C27H21N5S/c1-31-23-12-19(8-9-20(23)15-28-31)26-22-14-25-21(27(22)30-29-26)13-24(33-25)18-6-4-17(5-7-18)16-32-10-2-3-11-32/h2-13,15H,14,16H2,1H3,(H,29,30) |
| InChIKey | CTCVFWGNCMQDHM-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |