C32H29Cl2N5O5 — CID 163362962
tert-butyl N-[[4-chloro-3-(2-chloro-4-phenoxybenzoyl)-1H-pyrrolo[2,3-b]pyridine-5-carbonyl]-(3-cyanocyclopentyl)amino]carbamate (PubChem CID 163362962) has the molecular formula C32H29Cl2N5O5 and a molecular weight of 634.52 g/mol. Its IUPAC name is tert-butyl N-[[4-chloro-3-(2-chloro-4-phenoxybenzoyl)-1H-pyrrolo[2,3-b]pyridine-5-carbonyl]-(3-cyanocyclopentyl)amino]carbamate.
| Compound Name | tert-butyl N-[[4-chloro-3-(2-chloro-4-phenoxybenzoyl)-1H-pyrrolo[2,3-b]pyridine-5-carbonyl]-(3-cyanocyclopentyl)amino]carbamate |
|---|---|
| PubChem CID | 163362962 |
| Molecular Formula | C32H29Cl2N5O5 |
| Molecular Weight | 634.52 g/mol |
| Exact Mass | 633.15 |
| IUPAC Name | tert-butyl N-[[4-chloro-3-(2-chloro-4-phenoxybenzoyl)-1H-pyrrolo[2,3-b]pyridine-5-carbonyl]-(3-cyanocyclopentyl)amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(C(=O)c1cnc2[nH]cc(C(=O)c3ccc(Oc4ccccc4)cc3Cl)c2c1Cl)C1CCC(C#N)C1 |
| InChI | InChI=1S/C32H29Cl2N5O5/c1-32(2,3)44-31(42)38-39(19-10-9-18(13-19)15-35)30(41)24-17-37-29-26(27(24)34)23(16-36-29)28(40)22-12-11-21(14-25(22)33)43-20-7-5-4-6-8-20/h4-8,11-12,14,16-19H,9-10,13H2,1-3H3,(H,36,37)(H,38,42) |
| InChIKey | GDKLRJXPEQEAGD-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.52 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|