C26H34N4O3SSi — CID 163363016
[3-[10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl]cyclohexyl]oxy-tert-butyl-dimethylsilane (PubChem CID 163363016) has the molecular formula C26H34N4O3SSi and a molecular weight of 510.74 g/mol. Its IUPAC name is [3-[10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl]cyclohexyl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [3-[10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl]cyclohexyl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 163363016 |
| Molecular Formula | C26H34N4O3SSi |
| Molecular Weight | 510.74 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | [3-[10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl]cyclohexyl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCC(c2nc3c(cnc4c3ccn4S(=O)(=O)c3ccccc3)[nH]2)C1 |
| InChI | InChI=1S/C26H34N4O3SSi/c1-26(2,3)35(4,5)33-19-11-9-10-18(16-19)24-28-22-17-27-25-21(23(22)29-24)14-15-30(25)34(31,32)20-12-7-6-8-13-20/h6-8,12-15,17-19H,9-11,16H2,1-5H3,(H,28,29) |
| InChIKey | SXAZCOWDJXFMLN-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.74 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|