C10H6Cl2F2O3 — CID 163363178
methyl 2,3-dichloro-6,7-difluoro-2,3-dihydro-1-benzofuran-5-carboxylate (PubChem CID 163363178) has the molecular formula C10H6Cl2F2O3 and a molecular weight of 283.06 g/mol. Its IUPAC name is methyl 2,3-dichloro-6,7-difluoro-2,3-dihydro-1-benzofuran-5-carboxylate.
| Compound Name | methyl 2,3-dichloro-6,7-difluoro-2,3-dihydro-1-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 163363178 |
| Molecular Formula | C10H6Cl2F2O3 |
| Molecular Weight | 283.06 g/mol |
| Exact Mass | 281.97 |
| IUPAC Name | methyl 2,3-dichloro-6,7-difluoro-2,3-dihydro-1-benzofuran-5-carboxylate |
| SMILES | COC(=O)c1cc2c(c(F)c1F)OC(Cl)C2Cl |
| InChI | InChI=1S/C10H6Cl2F2O3/c1-16-10(15)4-2-3-5(11)9(12)17-8(3)7(14)6(4)13/h2,5,9H,1H3 |
| InChIKey | GSSFOKWUKCFUPH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.06 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|