C23H18N4O3 — CID 163363433
(10E)-10-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-6-phenyl-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one (PubChem CID 163363433) has the molecular formula C23H18N4O3 and a molecular weight of 398.42 g/mol. Its IUPAC name is (10E)-10-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-6-phenyl-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one.
| Compound Name | (10E)-10-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-6-phenyl-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 163363433 |
| Molecular Formula | C23H18N4O3 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (10E)-10-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-6-phenyl-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
| SMILES | O=c1c2cnn(-c3ccccc3)c2nc2n1CC/C2=C\c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H18N4O3/c28-23-18-14-24-27(17-4-2-1-3-5-17)22(18)25-21-16(8-9-26(21)23)12-15-6-7-19-20(13-15)30-11-10-29-19/h1-7,12-14H,8-11H2/b16-12+ |
| InChIKey | JAKLOHUXYDKCJC-FOWTUZBSSA-N |
| XLogP | 3.30 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |