C18H18N4O2 — CID 163363443
(10E)-10-[(4-methoxyphenyl)methylidene]-6-methyl-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one (PubChem CID 163363443) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is (10E)-10-[(4-methoxyphenyl)methylidene]-6-methyl-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one.
| Compound Name | (10E)-10-[(4-methoxyphenyl)methylidene]-6-methyl-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 163363443 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (10E)-10-[(4-methoxyphenyl)methylidene]-6-methyl-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one |
| SMILES | COc1ccc(/C=C2\CCCn3c2nc2c(cnn2C)c3=O)cc1 |
| InChI | InChI=1S/C18H18N4O2/c1-21-17-15(11-19-21)18(23)22-9-3-4-13(16(22)20-17)10-12-5-7-14(24-2)8-6-12/h5-8,10-11H,3-4,9H2,1-2H3/b13-10+ |
| InChIKey | LOFYXBRFPXLGSY-JLHYYAGUSA-N |
| XLogP | 2.47 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |