About 1-ethenyl-2-ethyl-4,5-dimethylimidazole
1-ethenyl-2-ethyl-4,5-dimethylimidazole (PubChem CID 163363596) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 1-ethenyl-2-ethyl-4,5-dimethylimidazole.
Molecular Properties
| Compound Name | 1-ethenyl-2-ethyl-4,5-dimethylimidazole |
| PubChem CID | 163363596 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 1-ethenyl-2-ethyl-4,5-dimethylimidazole |
| SMILES | C=Cn1c(CC)nc(C)c1C |
| InChI | InChI=1S/C9H14N2/c1-5-9-10-7(3)8(4)11(9)6-2/h6H,2,5H2,1,3-4H3 |
| InChIKey | IUENOUBLROMMEW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethenyl-2-ethyl-4,5-dimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2-ethyl-4,5-dimethylimidazole?
The IUPAC name of 1-ethenyl-2-ethyl-4,5-dimethylimidazole (CID 163363596) is 1-ethenyl-2-ethyl-4,5-dimethylimidazole.
What is the SMILES notation for 1-ethenyl-2-ethyl-4,5-dimethylimidazole?
The canonical SMILES for 1-ethenyl-2-ethyl-4,5-dimethylimidazole is C=Cn1c(CC)nc(C)c1C.
What is the InChIKey of 1-ethenyl-2-ethyl-4,5-dimethylimidazole?
The InChIKey is IUENOUBLROMMEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-5-9-10-7(3)8(4)11(9)6-2/h6H,2,5H2,1,3-4H3.
What are the key properties of 1-ethenyl-2-ethyl-4,5-dimethylimidazole?
1-ethenyl-2-ethyl-4,5-dimethylimidazole has a molecular weight of 150.22 g/mol, XLogP of 2.16, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2-ethyl-4,5-dimethylimidazole is sourced from PubChem (CID 163363596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).