About (2-aminoacetyl) 2,3-dihydroxypropanoate
(2-aminoacetyl) 2,3-dihydroxypropanoate (PubChem CID 163363613) has the molecular formula C5H9NO5
and a molecular weight of 163.13 g/mol. Its IUPAC name is (2-aminoacetyl) 2,3-dihydroxypropanoate.
Molecular Properties
| Compound Name | (2-aminoacetyl) 2,3-dihydroxypropanoate |
| PubChem CID | 163363613 |
| Molecular Formula | C5H9NO5 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | (2-aminoacetyl) 2,3-dihydroxypropanoate |
| SMILES | NCC(=O)OC(=O)C(O)CO |
| InChI | InChI=1S/C5H9NO5/c6-1-4(9)11-5(10)3(8)2-7/h3,7-8H,1-2,6H2 |
| InChIKey | URSXHPCDNYKDLG-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2-aminoacetyl) 2,3-dihydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminoacetyl) 2,3-dihydroxypropanoate?
The IUPAC name of (2-aminoacetyl) 2,3-dihydroxypropanoate (CID 163363613) is (2-aminoacetyl) 2,3-dihydroxypropanoate.
What is the SMILES notation for (2-aminoacetyl) 2,3-dihydroxypropanoate?
The canonical SMILES for (2-aminoacetyl) 2,3-dihydroxypropanoate is NCC(=O)OC(=O)C(O)CO.
What is the InChIKey of (2-aminoacetyl) 2,3-dihydroxypropanoate?
The InChIKey is URSXHPCDNYKDLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO5/c6-1-4(9)11-5(10)3(8)2-7/h3,7-8H,1-2,6H2.
What are the key properties of (2-aminoacetyl) 2,3-dihydroxypropanoate?
(2-aminoacetyl) 2,3-dihydroxypropanoate has a molecular weight of 163.13 g/mol, XLogP of -2.63, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminoacetyl) 2,3-dihydroxypropanoate is sourced from PubChem (CID 163363613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).