C27H29N5O7S — CID 163363665
ethyl 4,6-diamino-5-cyano-1-(4-methylphenyl)sulfonyl-2-(3,4,5-trimethoxyphenyl)-2,3-dihydropyrrolo[2,3-b]pyridine-3-carboxylate (PubChem CID 163363665) has the molecular formula C27H29N5O7S and a molecular weight of 567.62 g/mol. Its IUPAC name is ethyl 4,6-diamino-5-cyano-1-(4-methylphenyl)sulfonyl-2-(3,4,5-trimethoxyphenyl)-2,3-dihydropyrrolo[2,3-b]pyridine-3-carboxylate.
| Compound Name | ethyl 4,6-diamino-5-cyano-1-(4-methylphenyl)sulfonyl-2-(3,4,5-trimethoxyphenyl)-2,3-dihydropyrrolo[2,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 163363665 |
| Molecular Formula | C27H29N5O7S |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | ethyl 4,6-diamino-5-cyano-1-(4-methylphenyl)sulfonyl-2-(3,4,5-trimethoxyphenyl)-2,3-dihydropyrrolo[2,3-b]pyridine-3-carboxylate |
| SMILES | CCOC(=O)C1c2c(nc(N)c(C#N)c2N)N(S(=O)(=O)c2ccc(C)cc2)C1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C27H29N5O7S/c1-6-39-27(33)21-20-22(29)17(13-28)25(30)31-26(20)32(40(34,35)16-9-7-14(2)8-10-16)23(21)15-11-18(36-3)24(38-5)19(12-15)37-4/h7-12,21,23H,6H2,1-5H3,(H4,29,30,31) |
| InChIKey | TWBLNMNYQRDUNH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 180.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |