C12H18N2O — CID 163363678
3-phenylmethoxycyclopentane-1,2-diamine (PubChem CID 163363678) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-phenylmethoxycyclopentane-1,2-diamine.
| Compound Name | 3-phenylmethoxycyclopentane-1,2-diamine |
|---|---|
| PubChem CID | 163363678 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 3-phenylmethoxycyclopentane-1,2-diamine |
| SMILES | NC1CCC(OCc2ccccc2)C1N |
| InChI | InChI=1S/C12H18N2O/c13-10-6-7-11(12(10)14)15-8-9-4-2-1-3-5-9/h1-5,10-12H,6-8,13-14H2 |
| InChIKey | YNYMIKLBTSWLSP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |