About 2-phenyl-6-(trifluoromethyl)furo[2,3-b]quinoxaline
2-phenyl-6-(trifluoromethyl)furo[2,3-b]quinoxaline (PubChem CID 163364251) has the molecular formula C17H9F3N2O
and a molecular weight of 314.27 g/mol. Its IUPAC name is 2-phenyl-6-(trifluoromethyl)furo[2,3-b]quinoxaline.
Molecular Properties
| Compound Name | 2-phenyl-6-(trifluoromethyl)furo[2,3-b]quinoxaline |
| PubChem CID | 163364251 |
| Molecular Formula | C17H9F3N2O |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-phenyl-6-(trifluoromethyl)furo[2,3-b]quinoxaline |
| SMILES | FC(F)(F)c1ccc2nc3oc(-c4ccccc4)cc3nc2c1 |
| InChI | InChI=1S/C17H9F3N2O/c18-17(19,20)11-6-7-12-13(8-11)21-14-9-15(23-16(14)22-12)10-4-2-1-3-5-10/h1-9H |
| InChIKey | RUWUXIDWYSOJBG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenyl-6-(trifluoromethyl)furo[2,3-b]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-6-(trifluoromethyl)furo[2,3-b]quinoxaline?
The IUPAC name of 2-phenyl-6-(trifluoromethyl)furo[2,3-b]quinoxaline (CID 163364251) is 2-phenyl-6-(trifluoromethyl)furo[2,3-b]quinoxaline.
What is the SMILES notation for 2-phenyl-6-(trifluoromethyl)furo[2,3-b]quinoxaline?
The canonical SMILES for 2-phenyl-6-(trifluoromethyl)furo[2,3-b]quinoxaline is FC(F)(F)c1ccc2nc3oc(-c4ccccc4)cc3nc2c1.
What is the InChIKey of 2-phenyl-6-(trifluoromethyl)furo[2,3-b]quinoxaline?
The InChIKey is RUWUXIDWYSOJBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9F3N2O/c18-17(19,20)11-6-7-12-13(8-11)21-14-9-15(23-16(14)22-12)10-4-2-1-3-5-10/h1-9H.
What are the key properties of 2-phenyl-6-(trifluoromethyl)furo[2,3-b]quinoxaline?
2-phenyl-6-(trifluoromethyl)furo[2,3-b]quinoxaline has a molecular weight of 314.27 g/mol, XLogP of 5.06, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-6-(trifluoromethyl)furo[2,3-b]quinoxaline is sourced from PubChem (CID 163364251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).