C11H14F3N3O2S — CID 163364307
[3-(2-hydroxypropan-2-yl)-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]thiourea (PubChem CID 163364307) has the molecular formula C11H14F3N3O2S and a molecular weight of 309.31 g/mol. Its IUPAC name is [3-(2-hydroxypropan-2-yl)-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]thiourea.
| Compound Name | [3-(2-hydroxypropan-2-yl)-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]thiourea |
|---|---|
| PubChem CID | 163364307 |
| Molecular Formula | C11H14F3N3O2S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | [3-(2-hydroxypropan-2-yl)-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]thiourea |
| SMILES | CC(C)(O)c1ccc(OCC(F)(F)F)nc1NC(N)=S |
| InChI | InChI=1S/C11H14F3N3O2S/c1-10(2,18)6-3-4-7(19-5-11(12,13)14)16-8(6)17-9(15)20/h3-4,18H,5H2,1-2H3,(H3,15,16,17,20) |
| InChIKey | SLVHVOZAIUZGJI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|