About 4,6-dichloro-5-(1,3-dioxol-2-ylmethyl)-2-methylpyrimidine
4,6-dichloro-5-(1,3-dioxol-2-ylmethyl)-2-methylpyrimidine (PubChem CID 163365426) has the molecular formula C9H8Cl2N2O2
and a molecular weight of 247.08 g/mol. Its IUPAC name is 4,6-dichloro-5-(1,3-dioxol-2-ylmethyl)-2-methylpyrimidine.
Molecular Properties
| Compound Name | 4,6-dichloro-5-(1,3-dioxol-2-ylmethyl)-2-methylpyrimidine |
| PubChem CID | 163365426 |
| Molecular Formula | C9H8Cl2N2O2 |
| Molecular Weight | 247.08 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | 4,6-dichloro-5-(1,3-dioxol-2-ylmethyl)-2-methylpyrimidine |
| SMILES | Cc1nc(Cl)c(CC2OC=CO2)c(Cl)n1 |
| InChI | InChI=1S/C9H8Cl2N2O2/c1-5-12-8(10)6(9(11)13-5)4-7-14-2-3-15-7/h2-3,7H,4H2,1H3 |
| InChIKey | TXDRKUYOPXARBI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.08 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,6-dichloro-5-(1,3-dioxol-2-ylmethyl)-2-methylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-5-(1,3-dioxol-2-ylmethyl)-2-methylpyrimidine?
The IUPAC name of 4,6-dichloro-5-(1,3-dioxol-2-ylmethyl)-2-methylpyrimidine (CID 163365426) is 4,6-dichloro-5-(1,3-dioxol-2-ylmethyl)-2-methylpyrimidine.
What is the SMILES notation for 4,6-dichloro-5-(1,3-dioxol-2-ylmethyl)-2-methylpyrimidine?
The canonical SMILES for 4,6-dichloro-5-(1,3-dioxol-2-ylmethyl)-2-methylpyrimidine is Cc1nc(Cl)c(CC2OC=CO2)c(Cl)n1.
What is the InChIKey of 4,6-dichloro-5-(1,3-dioxol-2-ylmethyl)-2-methylpyrimidine?
The InChIKey is TXDRKUYOPXARBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Cl2N2O2/c1-5-12-8(10)6(9(11)13-5)4-7-14-2-3-15-7/h2-3,7H,4H2,1H3.
What are the key properties of 4,6-dichloro-5-(1,3-dioxol-2-ylmethyl)-2-methylpyrimidine?
4,6-dichloro-5-(1,3-dioxol-2-ylmethyl)-2-methylpyrimidine has a molecular weight of 247.08 g/mol, XLogP of 2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-5-(1,3-dioxol-2-ylmethyl)-2-methylpyrimidine is sourced from PubChem (CID 163365426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).