About CID 163365837
CID 163365837 (PubChem CID 163365837) has the molecular formula C25H75O11Si12
and a molecular weight of 888.90 g/mol.
Molecular Properties
| Compound Name | CID 163365837 |
| PubChem CID | 163365837 |
| Molecular Formula | C25H75O11Si12 |
| Molecular Weight | 888.90 g/mol |
| Exact Mass | 887.25 |
| IUPAC Name | — |
| SMILES | C[Si](O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C25H75O11Si12/c1-37(26-38(2,3)4)27-40(8,9)29-42(12,13)31-44(16,17)33-46(20,21)35-48(24,25)36-47(22,23)34-45(18,19)32-43(14,15)30-41(10,11)28-39(5,6)7/h1-25H3 |
| InChIKey | QIKIJWGKTYTNRW-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 888.90 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 163365837 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163365837?
The IUPAC name of CID 163365837 (CID 163365837) is not available.
What is the SMILES notation for CID 163365837?
The canonical SMILES for CID 163365837 is C[Si](O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C.
What is the InChIKey of CID 163365837?
The InChIKey is QIKIJWGKTYTNRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H75O11Si12/c1-37(26-38(2,3)4)27-40(8,9)29-42(12,13)31-44(16,17)33-46(20,21)35-48(24,25)36-47(22,23)34-45(18,19)32-43(14,15)30-41(10,11)28-39(5,6)7/h1-25H3.
What are the key properties of CID 163365837?
CID 163365837 has a molecular weight of 888.90 g/mol, XLogP of 9.27, 22 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163365837 is sourced from PubChem (CID 163365837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).