C18H27F3O — CID 163366286
(1R,6S,9R)-6,10,10-trimethyl-2-(4,4,4-trifluorobutyl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene (PubChem CID 163366286) has the molecular formula C18H27F3O and a molecular weight of 316.41 g/mol. Its IUPAC name is (1R,6S,9R)-6,10,10-trimethyl-2-(4,4,4-trifluorobutyl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene.
| Compound Name | (1R,6S,9R)-6,10,10-trimethyl-2-(4,4,4-trifluorobutyl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene |
|---|---|
| PubChem CID | 163366286 |
| Molecular Formula | C18H27F3O |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (1R,6S,9R)-6,10,10-trimethyl-2-(4,4,4-trifluorobutyl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene |
| SMILES | CC1(C)O[C@]23C[C@H]1CC[C@]2(C)CCC=C3CCCC(F)(F)F |
| InChI | InChI=1S/C18H27F3O/c1-15(2)14-8-11-16(3)9-4-6-13(17(16,12-14)22-15)7-5-10-18(19,20)21/h6,14H,4-5,7-12H2,1-3H3/t14-,16+,17+/m1/s1 |
| InChIKey | REFSOUZNHGEPPY-PVAVHDDUSA-N |
| XLogP | 5.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|