About 5-[1-[3,5-difluoro-4-(3-methoxyphenyl)phenyl]triazol-4-yl]pyrimidin-2-amine
5-[1-[3,5-difluoro-4-(3-methoxyphenyl)phenyl]triazol-4-yl]pyrimidin-2-amine (PubChem CID 163366439) has the molecular formula C19H14F2N6O
and a molecular weight of 380.36 g/mol. Its IUPAC name is 5-[1-[3,5-difluoro-4-(3-methoxyphenyl)phenyl]triazol-4-yl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-[1-[3,5-difluoro-4-(3-methoxyphenyl)phenyl]triazol-4-yl]pyrimidin-2-amine |
| PubChem CID | 163366439 |
| Molecular Formula | C19H14F2N6O |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 5-[1-[3,5-difluoro-4-(3-methoxyphenyl)phenyl]triazol-4-yl]pyrimidin-2-amine |
| SMILES | COc1cccc(-c2c(F)cc(-n3cc(-c4cnc(N)nc4)nn3)cc2F)c1 |
| InChI | InChI=1S/C19H14F2N6O/c1-28-14-4-2-3-11(5-14)18-15(20)6-13(7-16(18)21)27-10-17(25-26-27)12-8-23-19(22)24-9-12/h2-10H,1H3,(H2,22,23,24) |
| InChIKey | LSSMBMZPWARAHI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[1-[3,5-difluoro-4-(3-methoxyphenyl)phenyl]triazol-4-yl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-[3,5-difluoro-4-(3-methoxyphenyl)phenyl]triazol-4-yl]pyrimidin-2-amine?
The IUPAC name of 5-[1-[3,5-difluoro-4-(3-methoxyphenyl)phenyl]triazol-4-yl]pyrimidin-2-amine (CID 163366439) is 5-[1-[3,5-difluoro-4-(3-methoxyphenyl)phenyl]triazol-4-yl]pyrimidin-2-amine.
What is the SMILES notation for 5-[1-[3,5-difluoro-4-(3-methoxyphenyl)phenyl]triazol-4-yl]pyrimidin-2-amine?
The canonical SMILES for 5-[1-[3,5-difluoro-4-(3-methoxyphenyl)phenyl]triazol-4-yl]pyrimidin-2-amine is COc1cccc(-c2c(F)cc(-n3cc(-c4cnc(N)nc4)nn3)cc2F)c1.
What is the InChIKey of 5-[1-[3,5-difluoro-4-(3-methoxyphenyl)phenyl]triazol-4-yl]pyrimidin-2-amine?
The InChIKey is LSSMBMZPWARAHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F2N6O/c1-28-14-4-2-3-11(5-14)18-15(20)6-13(7-16(18)21)27-10-17(25-26-27)12-8-23-19(22)24-9-12/h2-10H,1H3,(H2,22,23,24).
What are the key properties of 5-[1-[3,5-difluoro-4-(3-methoxyphenyl)phenyl]triazol-4-yl]pyrimidin-2-amine?
5-[1-[3,5-difluoro-4-(3-methoxyphenyl)phenyl]triazol-4-yl]pyrimidin-2-amine has a molecular weight of 380.36 g/mol, XLogP of 3.26, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-[3,5-difluoro-4-(3-methoxyphenyl)phenyl]triazol-4-yl]pyrimidin-2-amine is sourced from PubChem (CID 163366439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).