About 1,3-dimethylurea
1,3-dimethylurea (PubChem CID 163366790) has the molecular formula C9H24N6O3
and a molecular weight of 264.33 g/mol. Its IUPAC name is 1,3-dimethylurea.
Molecular Properties
| Compound Name | 1,3-dimethylurea |
| PubChem CID | 163366790 |
| Molecular Formula | C9H24N6O3 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 1,3-dimethylurea |
| SMILES | CNC(=O)NC.CNC(=O)NC.CNC(=O)NC |
| InChI | InChI=1S/3C3H8N2O/c3*1-4-3(6)5-2/h3*1-2H3,(H2,4,5,6) |
| InChIKey | SSICYYDZPAIJDL-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 123.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylurea?
The IUPAC name of 1,3-dimethylurea (CID 163366790) is 1,3-dimethylurea.
What is the SMILES notation for 1,3-dimethylurea?
The canonical SMILES for 1,3-dimethylurea is CNC(=O)NC.CNC(=O)NC.CNC(=O)NC.
What is the InChIKey of 1,3-dimethylurea?
The InChIKey is SSICYYDZPAIJDL-UHFFFAOYSA-N. The full InChI is InChI=1S/3C3H8N2O/c3*1-4-3(6)5-2/h3*1-2H3,(H2,4,5,6).
What are the key properties of 1,3-dimethylurea?
1,3-dimethylurea has a molecular weight of 264.33 g/mol, XLogP of -1.36, 0 rotatable bonds, 6 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylurea is sourced from PubChem (CID 163366790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).