C25H20F3N3O2S — CID 163367109
N-(2,3-dihydro-1,4-benzoxazin-4-yl)-3-propan-2-yl-7-(2,3,5-trifluorophenyl)thieno[2,3-c]pyridine-2-carboxamide (PubChem CID 163367109) has the molecular formula C25H20F3N3O2S and a molecular weight of 483.52 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzoxazin-4-yl)-3-propan-2-yl-7-(2,3,5-trifluorophenyl)thieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzoxazin-4-yl)-3-propan-2-yl-7-(2,3,5-trifluorophenyl)thieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 163367109 |
| Molecular Formula | C25H20F3N3O2S |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzoxazin-4-yl)-3-propan-2-yl-7-(2,3,5-trifluorophenyl)thieno[2,3-c]pyridine-2-carboxamide |
| SMILES | CC(C)c1c(C(=O)NN2CCOc3ccccc32)sc2c(-c3cc(F)cc(F)c3F)nccc12 |
| InChI | InChI=1S/C25H20F3N3O2S/c1-13(2)20-15-7-8-29-22(16-11-14(26)12-17(27)21(16)28)23(15)34-24(20)25(32)30-31-9-10-33-19-6-4-3-5-18(19)31/h3-8,11-13H,9-10H2,1-2H3,(H,30,32) |
| InChIKey | UXJCOUJOSOKQEU-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|