About ethane;ethyl 3-methyl-7-(2,3,5-trifluorophenyl)-1H-indole-2-carboxylate
ethane;ethyl 3-methyl-7-(2,3,5-trifluorophenyl)-1H-indole-2-carboxylate (PubChem CID 163367153) has the molecular formula C20H20F3NO2
and a molecular weight of 363.38 g/mol. Its IUPAC name is ethane;ethyl 3-methyl-7-(2,3,5-trifluorophenyl)-1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | ethane;ethyl 3-methyl-7-(2,3,5-trifluorophenyl)-1H-indole-2-carboxylate |
| PubChem CID | 163367153 |
| Molecular Formula | C20H20F3NO2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | ethane;ethyl 3-methyl-7-(2,3,5-trifluorophenyl)-1H-indole-2-carboxylate |
| SMILES | CC.CCOC(=O)c1[nH]c2c(-c3cc(F)cc(F)c3F)cccc2c1C |
| InChI | InChI=1S/C18H14F3NO2.C2H6/c1-3-24-18(23)16-9(2)11-5-4-6-12(17(11)22-16)13-7-10(19)8-14(20)15(13)21;1-2/h4-8,22H,3H2,1-2H3;1-2H3 |
| InChIKey | WCFOQYMQAMXZKV-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethyl 3-methyl-7-(2,3,5-trifluorophenyl)-1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl 3-methyl-7-(2,3,5-trifluorophenyl)-1H-indole-2-carboxylate?
The IUPAC name of ethane;ethyl 3-methyl-7-(2,3,5-trifluorophenyl)-1H-indole-2-carboxylate (CID 163367153) is ethane;ethyl 3-methyl-7-(2,3,5-trifluorophenyl)-1H-indole-2-carboxylate.
What is the SMILES notation for ethane;ethyl 3-methyl-7-(2,3,5-trifluorophenyl)-1H-indole-2-carboxylate?
The canonical SMILES for ethane;ethyl 3-methyl-7-(2,3,5-trifluorophenyl)-1H-indole-2-carboxylate is CC.CCOC(=O)c1[nH]c2c(-c3cc(F)cc(F)c3F)cccc2c1C.
What is the InChIKey of ethane;ethyl 3-methyl-7-(2,3,5-trifluorophenyl)-1H-indole-2-carboxylate?
The InChIKey is WCFOQYMQAMXZKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F3NO2.C2H6/c1-3-24-18(23)16-9(2)11-5-4-6-12(17(11)22-16)13-7-10(19)8-14(20)15(13)21;1-2/h4-8,22H,3H2,1-2H3;1-2H3.
What are the key properties of ethane;ethyl 3-methyl-7-(2,3,5-trifluorophenyl)-1H-indole-2-carboxylate?
ethane;ethyl 3-methyl-7-(2,3,5-trifluorophenyl)-1H-indole-2-carboxylate has a molecular weight of 363.38 g/mol, XLogP of 5.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl 3-methyl-7-(2,3,5-trifluorophenyl)-1H-indole-2-carboxylate is sourced from PubChem (CID 163367153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).