About N-[4-(4-fluoro-1,3-benzoxazol-2-yl)phenyl]-1,3-thiazole-2-carboxamide
N-[4-(4-fluoro-1,3-benzoxazol-2-yl)phenyl]-1,3-thiazole-2-carboxamide (PubChem CID 163367405) has the molecular formula C17H10FN3O2S
and a molecular weight of 339.35 g/mol. Its IUPAC name is N-[4-(4-fluoro-1,3-benzoxazol-2-yl)phenyl]-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | N-[4-(4-fluoro-1,3-benzoxazol-2-yl)phenyl]-1,3-thiazole-2-carboxamide |
| PubChem CID | 163367405 |
| Molecular Formula | C17H10FN3O2S |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | N-[4-(4-fluoro-1,3-benzoxazol-2-yl)phenyl]-1,3-thiazole-2-carboxamide |
| SMILES | O=C(Nc1ccc(-c2nc3c(F)cccc3o2)cc1)c1nccs1 |
| InChI | InChI=1S/C17H10FN3O2S/c18-12-2-1-3-13-14(12)21-16(23-13)10-4-6-11(7-5-10)20-15(22)17-19-8-9-24-17/h1-9H,(H,20,22) |
| InChIKey | WBVUIDHSQFNNFL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-(4-fluoro-1,3-benzoxazol-2-yl)phenyl]-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(4-fluoro-1,3-benzoxazol-2-yl)phenyl]-1,3-thiazole-2-carboxamide?
The IUPAC name of N-[4-(4-fluoro-1,3-benzoxazol-2-yl)phenyl]-1,3-thiazole-2-carboxamide (CID 163367405) is N-[4-(4-fluoro-1,3-benzoxazol-2-yl)phenyl]-1,3-thiazole-2-carboxamide.
What is the SMILES notation for N-[4-(4-fluoro-1,3-benzoxazol-2-yl)phenyl]-1,3-thiazole-2-carboxamide?
The canonical SMILES for N-[4-(4-fluoro-1,3-benzoxazol-2-yl)phenyl]-1,3-thiazole-2-carboxamide is O=C(Nc1ccc(-c2nc3c(F)cccc3o2)cc1)c1nccs1.
What is the InChIKey of N-[4-(4-fluoro-1,3-benzoxazol-2-yl)phenyl]-1,3-thiazole-2-carboxamide?
The InChIKey is WBVUIDHSQFNNFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10FN3O2S/c18-12-2-1-3-13-14(12)21-16(23-13)10-4-6-11(7-5-10)20-15(22)17-19-8-9-24-17/h1-9H,(H,20,22).
What are the key properties of N-[4-(4-fluoro-1,3-benzoxazol-2-yl)phenyl]-1,3-thiazole-2-carboxamide?
N-[4-(4-fluoro-1,3-benzoxazol-2-yl)phenyl]-1,3-thiazole-2-carboxamide has a molecular weight of 339.35 g/mol, XLogP of 4.34, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(4-fluoro-1,3-benzoxazol-2-yl)phenyl]-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 163367405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).