C15H25NO — CID 163368220
1-[(5Z,7Z)-1-amino-2,9-dimethyldeca-5,7,9-trien-2-yl]cyclopropan-1-ol (PubChem CID 163368220) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 1-[(5Z,7Z)-1-amino-2,9-dimethyldeca-5,7,9-trien-2-yl]cyclopropan-1-ol.
| Compound Name | 1-[(5Z,7Z)-1-amino-2,9-dimethyldeca-5,7,9-trien-2-yl]cyclopropan-1-ol |
|---|---|
| PubChem CID | 163368220 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 1-[(5Z,7Z)-1-amino-2,9-dimethyldeca-5,7,9-trien-2-yl]cyclopropan-1-ol |
| SMILES | C=C(C)/C=C\C=C/CCC(C)(CN)C1(O)CC1 |
| InChI | InChI=1S/C15H25NO/c1-13(2)8-6-4-5-7-9-14(3,12-16)15(17)10-11-15/h4-6,8,17H,1,7,9-12,16H2,2-3H3/b5-4-,8-6- |
| InChIKey | NFCLULKUXQSQSJ-NADLECRISA-N |
| XLogP | 2.94 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|