C25H35N7O3S — CID 163368415
2-[4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]-N-[4-(4-acetylpiperazin-1-yl)phenyl]acetamide (PubChem CID 163368415) has the molecular formula C25H35N7O3S and a molecular weight of 513.67 g/mol. Its IUPAC name is 2-[4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]-N-[4-(4-acetylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-[4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]-N-[4-(4-acetylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 163368415 |
| Molecular Formula | C25H35N7O3S |
| Molecular Weight | 513.67 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | 2-[4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-3-methylpiperazin-1-yl]-N-[4-(4-acetylpiperazin-1-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ncc(CN2CCN(CC(=O)Nc3ccc(N4CCN(C(C)=O)CC4)cc3)CC2C)s1 |
| InChI | InChI=1S/C25H35N7O3S/c1-18-15-29(8-9-32(18)16-23-14-26-25(36-23)27-19(2)33)17-24(35)28-21-4-6-22(7-5-21)31-12-10-30(11-13-31)20(3)34/h4-7,14,18H,8-13,15-17H2,1-3H3,(H,28,35)(H,26,27,33) |
| InChIKey | FFRFPWFNEJVXIQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 101.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.67 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|