About 1-[(2-acetamido-1,3-thiazol-5-yl)methyl]-N-phenylpiperidine-3-carboxamide
1-[(2-acetamido-1,3-thiazol-5-yl)methyl]-N-phenylpiperidine-3-carboxamide (PubChem CID 163368443) has the molecular formula C18H22N4O2S
and a molecular weight of 358.47 g/mol. Its IUPAC name is 1-[(2-acetamido-1,3-thiazol-5-yl)methyl]-N-phenylpiperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-[(2-acetamido-1,3-thiazol-5-yl)methyl]-N-phenylpiperidine-3-carboxamide |
| PubChem CID | 163368443 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-[(2-acetamido-1,3-thiazol-5-yl)methyl]-N-phenylpiperidine-3-carboxamide |
| SMILES | CC(=O)Nc1ncc(CN2CCCC(C(=O)Nc3ccccc3)C2)s1 |
| InChI | InChI=1S/C18H22N4O2S/c1-13(23)20-18-19-10-16(25-18)12-22-9-5-6-14(11-22)17(24)21-15-7-3-2-4-8-15/h2-4,7-8,10,14H,5-6,9,11-12H2,1H3,(H,21,24)(H,19,20,23) |
| InChIKey | KDWDKRBHVSULHG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(2-acetamido-1,3-thiazol-5-yl)methyl]-N-phenylpiperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-acetamido-1,3-thiazol-5-yl)methyl]-N-phenylpiperidine-3-carboxamide?
The IUPAC name of 1-[(2-acetamido-1,3-thiazol-5-yl)methyl]-N-phenylpiperidine-3-carboxamide (CID 163368443) is 1-[(2-acetamido-1,3-thiazol-5-yl)methyl]-N-phenylpiperidine-3-carboxamide.
What is the SMILES notation for 1-[(2-acetamido-1,3-thiazol-5-yl)methyl]-N-phenylpiperidine-3-carboxamide?
The canonical SMILES for 1-[(2-acetamido-1,3-thiazol-5-yl)methyl]-N-phenylpiperidine-3-carboxamide is CC(=O)Nc1ncc(CN2CCCC(C(=O)Nc3ccccc3)C2)s1.
What is the InChIKey of 1-[(2-acetamido-1,3-thiazol-5-yl)methyl]-N-phenylpiperidine-3-carboxamide?
The InChIKey is KDWDKRBHVSULHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O2S/c1-13(23)20-18-19-10-16(25-18)12-22-9-5-6-14(11-22)17(24)21-15-7-3-2-4-8-15/h2-4,7-8,10,14H,5-6,9,11-12H2,1H3,(H,21,24)(H,19,20,23).
What are the key properties of 1-[(2-acetamido-1,3-thiazol-5-yl)methyl]-N-phenylpiperidine-3-carboxamide?
1-[(2-acetamido-1,3-thiazol-5-yl)methyl]-N-phenylpiperidine-3-carboxamide has a molecular weight of 358.47 g/mol, XLogP of 2.95, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-acetamido-1,3-thiazol-5-yl)methyl]-N-phenylpiperidine-3-carboxamide is sourced from PubChem (CID 163368443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).