C21H26N4O3S — CID 163368455
2-[1-[(2-acetamido-1,3-thiazol-5-yl)methyl]piperidin-4-ylidene]-N-[(4-methoxyphenyl)methyl]acetamide (PubChem CID 163368455) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-[1-[(2-acetamido-1,3-thiazol-5-yl)methyl]piperidin-4-ylidene]-N-[(4-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[1-[(2-acetamido-1,3-thiazol-5-yl)methyl]piperidin-4-ylidene]-N-[(4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 163368455 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 2-[1-[(2-acetamido-1,3-thiazol-5-yl)methyl]piperidin-4-ylidene]-N-[(4-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)C=C2CCN(Cc3cnc(NC(C)=O)s3)CC2)cc1 |
| InChI | InChI=1S/C21H26N4O3S/c1-15(26)24-21-23-13-19(29-21)14-25-9-7-16(8-10-25)11-20(27)22-12-17-3-5-18(28-2)6-4-17/h3-6,11,13H,7-10,12,14H2,1-2H3,(H,22,27)(H,23,24,26) |
| InChIKey | LXUWDDYPJUVINL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|