C23H22N4O — CID 163368568
2-methanimidoyl-4-[3-(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridin-6-yl]aniline (PubChem CID 163368568) has the molecular formula C23H22N4O and a molecular weight of 370.46 g/mol. Its IUPAC name is 2-methanimidoyl-4-[3-(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridin-6-yl]aniline.
| Compound Name | 2-methanimidoyl-4-[3-(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridin-6-yl]aniline |
|---|---|
| PubChem CID | 163368568 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 2-methanimidoyl-4-[3-(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridin-6-yl]aniline |
| SMILES | [H]/N=C/c1cc(-c2ccc3ncc(-c4ccc(OC(C)C)cc4)n3c2)ccc1N |
| InChI | InChI=1S/C23H22N4O/c1-15(2)28-20-7-3-16(4-8-20)22-13-26-23-10-6-18(14-27(22)23)17-5-9-21(25)19(11-17)12-24/h3-15,24H,25H2,1-2H3/b24-12+ |
| InChIKey | HVZBAAYOCBPSMM-WYMPLXKRSA-N |
| XLogP | 5.04 |
| TPSA | 76.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|