About (2E)-5,5-dimethyl-3-methylidene-2-propylidenecyclohexan-1-one
(2E)-5,5-dimethyl-3-methylidene-2-propylidenecyclohexan-1-one (PubChem CID 163368977) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is (2E)-5,5-dimethyl-3-methylidene-2-propylidenecyclohexan-1-one.
Molecular Properties
| Compound Name | (2E)-5,5-dimethyl-3-methylidene-2-propylidenecyclohexan-1-one |
| PubChem CID | 163368977 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (2E)-5,5-dimethyl-3-methylidene-2-propylidenecyclohexan-1-one |
| SMILES | C=C1CC(C)(C)CC(=O)/C1=C/CC |
| InChI | InChI=1S/C12H18O/c1-5-6-10-9(2)7-12(3,4)8-11(10)13/h6H,2,5,7-8H2,1,3-4H3/b10-6+ |
| InChIKey | XTAUFWRRFGNWKH-UXBLZVDNSA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-5,5-dimethyl-3-methylidene-2-propylidenecyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-5,5-dimethyl-3-methylidene-2-propylidenecyclohexan-1-one?
The IUPAC name of (2E)-5,5-dimethyl-3-methylidene-2-propylidenecyclohexan-1-one (CID 163368977) is (2E)-5,5-dimethyl-3-methylidene-2-propylidenecyclohexan-1-one.
What is the SMILES notation for (2E)-5,5-dimethyl-3-methylidene-2-propylidenecyclohexan-1-one?
The canonical SMILES for (2E)-5,5-dimethyl-3-methylidene-2-propylidenecyclohexan-1-one is C=C1CC(C)(C)CC(=O)/C1=C/CC.
What is the InChIKey of (2E)-5,5-dimethyl-3-methylidene-2-propylidenecyclohexan-1-one?
The InChIKey is XTAUFWRRFGNWKH-UXBLZVDNSA-N. The full InChI is InChI=1S/C12H18O/c1-5-6-10-9(2)7-12(3,4)8-11(10)13/h6H,2,5,7-8H2,1,3-4H3/b10-6+.
What are the key properties of (2E)-5,5-dimethyl-3-methylidene-2-propylidenecyclohexan-1-one?
(2E)-5,5-dimethyl-3-methylidene-2-propylidenecyclohexan-1-one has a molecular weight of 178.27 g/mol, XLogP of 3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-5,5-dimethyl-3-methylidene-2-propylidenecyclohexan-1-one is sourced from PubChem (CID 163368977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).