C21H20ClFN6OS — CID 163369107
6-[3-[(5-chloro-2-methoxy-3-pyridinyl)sulfanylamino]-5-fluorophenyl]pyrido[2,3-d]pyrimidin-2-amine;ethane (PubChem CID 163369107) has the molecular formula C21H20ClFN6OS and a molecular weight of 458.95 g/mol. Its IUPAC name is 6-[3-[(5-chloro-2-methoxy-3-pyridinyl)sulfanylamino]-5-fluorophenyl]pyrido[2,3-d]pyrimidin-2-amine;ethane.
| Compound Name | 6-[3-[(5-chloro-2-methoxy-3-pyridinyl)sulfanylamino]-5-fluorophenyl]pyrido[2,3-d]pyrimidin-2-amine;ethane |
|---|---|
| PubChem CID | 163369107 |
| Molecular Formula | C21H20ClFN6OS |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 6-[3-[(5-chloro-2-methoxy-3-pyridinyl)sulfanylamino]-5-fluorophenyl]pyrido[2,3-d]pyrimidin-2-amine;ethane |
| SMILES | CC.COc1ncc(Cl)cc1SNc1cc(F)cc(-c2cnc3nc(N)ncc3c2)c1 |
| InChI | InChI=1S/C19H14ClFN6OS.C2H6/c1-28-18-16(5-13(20)9-24-18)29-27-15-4-10(3-14(21)6-15)11-2-12-8-25-19(22)26-17(12)23-7-11;1-2/h2-9,27H,1H3,(H2,22,23,25,26);1-2H3 |
| InChIKey | CCPGGHXHFWNJDM-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|