C15H21BN4O3 — CID 163369223
7-methoxy-N-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[2,3-d]pyrimidin-2-amine (PubChem CID 163369223) has the molecular formula C15H21BN4O3 and a molecular weight of 316.17 g/mol. Its IUPAC name is 7-methoxy-N-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[2,3-d]pyrimidin-2-amine.
| Compound Name | 7-methoxy-N-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 163369223 |
| Molecular Formula | C15H21BN4O3 |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 7-methoxy-N-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[2,3-d]pyrimidin-2-amine |
| SMILES | CNc1ncc2cc(B3OC(C)(C)C(C)(C)O3)c(OC)nc2n1 |
| InChI | InChI=1S/C15H21BN4O3/c1-14(2)15(3,4)23-16(22-14)10-7-9-8-18-13(17-5)20-11(9)19-12(10)21-6/h7-8H,1-6H3,(H,17,18,19,20) |
| InChIKey | NPOIQRHTIGDWLN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|