C19H16F2N2O3 — CID 163369643
3-(3,5-difluoro-4-hydroxyanilino)-1-[(2,4-dimethylphenyl)methyl]pyrrole-2,5-dione (PubChem CID 163369643) has the molecular formula C19H16F2N2O3 and a molecular weight of 358.34 g/mol. Its IUPAC name is 3-(3,5-difluoro-4-hydroxyanilino)-1-[(2,4-dimethylphenyl)methyl]pyrrole-2,5-dione.
| Compound Name | 3-(3,5-difluoro-4-hydroxyanilino)-1-[(2,4-dimethylphenyl)methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 163369643 |
| Molecular Formula | C19H16F2N2O3 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 3-(3,5-difluoro-4-hydroxyanilino)-1-[(2,4-dimethylphenyl)methyl]pyrrole-2,5-dione |
| SMILES | Cc1ccc(CN2C(=O)C=C(Nc3cc(F)c(O)c(F)c3)C2=O)c(C)c1 |
| InChI | InChI=1S/C19H16F2N2O3/c1-10-3-4-12(11(2)5-10)9-23-17(24)8-16(19(23)26)22-13-6-14(20)18(25)15(21)7-13/h3-8,22,25H,9H2,1-2H3 |
| InChIKey | ROLPIKYRWIVGRM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|