About 3-(2,5-difluoro-4-hydroxyanilino)-1-phenylpyrrole-2,5-dione
3-(2,5-difluoro-4-hydroxyanilino)-1-phenylpyrrole-2,5-dione (PubChem CID 163369655) has the molecular formula C16H10F2N2O3
and a molecular weight of 316.26 g/mol. Its IUPAC name is 3-(2,5-difluoro-4-hydroxyanilino)-1-phenylpyrrole-2,5-dione.
Molecular Properties
| Compound Name | 3-(2,5-difluoro-4-hydroxyanilino)-1-phenylpyrrole-2,5-dione |
| PubChem CID | 163369655 |
| Molecular Formula | C16H10F2N2O3 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 3-(2,5-difluoro-4-hydroxyanilino)-1-phenylpyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2cc(F)c(O)cc2F)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C16H10F2N2O3/c17-10-7-14(21)11(18)6-12(10)19-13-8-15(22)20(16(13)23)9-4-2-1-3-5-9/h1-8,19,21H |
| InChIKey | GBNAJUVVYRIPNO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-difluoro-4-hydroxyanilino)-1-phenylpyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-difluoro-4-hydroxyanilino)-1-phenylpyrrole-2,5-dione?
The IUPAC name of 3-(2,5-difluoro-4-hydroxyanilino)-1-phenylpyrrole-2,5-dione (CID 163369655) is 3-(2,5-difluoro-4-hydroxyanilino)-1-phenylpyrrole-2,5-dione.
What is the SMILES notation for 3-(2,5-difluoro-4-hydroxyanilino)-1-phenylpyrrole-2,5-dione?
The canonical SMILES for 3-(2,5-difluoro-4-hydroxyanilino)-1-phenylpyrrole-2,5-dione is O=C1C=C(Nc2cc(F)c(O)cc2F)C(=O)N1c1ccccc1.
What is the InChIKey of 3-(2,5-difluoro-4-hydroxyanilino)-1-phenylpyrrole-2,5-dione?
The InChIKey is GBNAJUVVYRIPNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F2N2O3/c17-10-7-14(21)11(18)6-12(10)19-13-8-15(22)20(16(13)23)9-4-2-1-3-5-9/h1-8,19,21H.
What are the key properties of 3-(2,5-difluoro-4-hydroxyanilino)-1-phenylpyrrole-2,5-dione?
3-(2,5-difluoro-4-hydroxyanilino)-1-phenylpyrrole-2,5-dione has a molecular weight of 316.26 g/mol, XLogP of 2.54, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-difluoro-4-hydroxyanilino)-1-phenylpyrrole-2,5-dione is sourced from PubChem (CID 163369655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).