About 2-[(4R)-2'-fluoro-1-oxo-6-(trifluoromethyl)spiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetic acid
2-[(4R)-2'-fluoro-1-oxo-6-(trifluoromethyl)spiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetic acid (PubChem CID 163370963) has the molecular formula C14H11F4NO3
and a molecular weight of 317.24 g/mol. Its IUPAC name is 2-[(4R)-2'-fluoro-1-oxo-6-(trifluoromethyl)spiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(4R)-2'-fluoro-1-oxo-6-(trifluoromethyl)spiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetic acid |
| PubChem CID | 163370963 |
| Molecular Formula | C14H11F4NO3 |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2-[(4R)-2'-fluoro-1-oxo-6-(trifluoromethyl)spiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetic acid |
| SMILES | O=C(O)CN1C[C@@]2(CC2F)c2cc(C(F)(F)F)ccc2C1=O |
| InChI | InChI=1S/C14H11F4NO3/c15-10-4-13(10)6-19(5-11(20)21)12(22)8-2-1-7(3-9(8)13)14(16,17)18/h1-3,10H,4-6H2,(H,20,21)/t10?,13-/m0/s1 |
| InChIKey | TZFZWOYBFPBQLD-HQVZTVAUSA-N |
| XLogP | 2.23 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(4R)-2'-fluoro-1-oxo-6-(trifluoromethyl)spiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4R)-2'-fluoro-1-oxo-6-(trifluoromethyl)spiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetic acid?
The IUPAC name of 2-[(4R)-2'-fluoro-1-oxo-6-(trifluoromethyl)spiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetic acid (CID 163370963) is 2-[(4R)-2'-fluoro-1-oxo-6-(trifluoromethyl)spiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetic acid.
What is the SMILES notation for 2-[(4R)-2'-fluoro-1-oxo-6-(trifluoromethyl)spiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetic acid?
The canonical SMILES for 2-[(4R)-2'-fluoro-1-oxo-6-(trifluoromethyl)spiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetic acid is O=C(O)CN1C[C@@]2(CC2F)c2cc(C(F)(F)F)ccc2C1=O.
What is the InChIKey of 2-[(4R)-2'-fluoro-1-oxo-6-(trifluoromethyl)spiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetic acid?
The InChIKey is TZFZWOYBFPBQLD-HQVZTVAUSA-N. The full InChI is InChI=1S/C14H11F4NO3/c15-10-4-13(10)6-19(5-11(20)21)12(22)8-2-1-7(3-9(8)13)14(16,17)18/h1-3,10H,4-6H2,(H,20,21)/t10?,13-/m0/s1.
What are the key properties of 2-[(4R)-2'-fluoro-1-oxo-6-(trifluoromethyl)spiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetic acid?
2-[(4R)-2'-fluoro-1-oxo-6-(trifluoromethyl)spiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetic acid has a molecular weight of 317.24 g/mol, XLogP of 2.23, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4R)-2'-fluoro-1-oxo-6-(trifluoromethyl)spiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl]acetic acid is sourced from PubChem (CID 163370963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).