About 6-(1-fluorocyclopropyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one
6-(1-fluorocyclopropyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one (PubChem CID 163371035) has the molecular formula C14H14FNO
and a molecular weight of 231.27 g/mol. Its IUPAC name is 6-(1-fluorocyclopropyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one.
Molecular Properties
| Compound Name | 6-(1-fluorocyclopropyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one |
| PubChem CID | 163371035 |
| Molecular Formula | C14H14FNO |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 6-(1-fluorocyclopropyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one |
| SMILES | O=C1NCC2(CC2)c2cc(C3(F)CC3)ccc21 |
| InChI | InChI=1S/C14H14FNO/c15-14(5-6-14)9-1-2-10-11(7-9)13(3-4-13)8-16-12(10)17/h1-2,7H,3-6,8H2,(H,16,17) |
| InChIKey | MURRZEKTDLLILL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-(1-fluorocyclopropyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-fluorocyclopropyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one?
The IUPAC name of 6-(1-fluorocyclopropyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one (CID 163371035) is 6-(1-fluorocyclopropyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one.
What is the SMILES notation for 6-(1-fluorocyclopropyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one?
The canonical SMILES for 6-(1-fluorocyclopropyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one is O=C1NCC2(CC2)c2cc(C3(F)CC3)ccc21.
What is the InChIKey of 6-(1-fluorocyclopropyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one?
The InChIKey is MURRZEKTDLLILL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14FNO/c15-14(5-6-14)9-1-2-10-11(7-9)13(3-4-13)8-16-12(10)17/h1-2,7H,3-6,8H2,(H,16,17).
What are the key properties of 6-(1-fluorocyclopropyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one?
6-(1-fluorocyclopropyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one has a molecular weight of 231.27 g/mol, XLogP of 2.42, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-fluorocyclopropyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one is sourced from PubChem (CID 163371035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).