About 2-(6-cyclopropyl-2'-fluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl)acetamide
2-(6-cyclopropyl-2'-fluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl)acetamide (PubChem CID 163371362) has the molecular formula C16H17FN2O2
and a molecular weight of 288.32 g/mol. Its IUPAC name is 2-(6-cyclopropyl-2'-fluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(6-cyclopropyl-2'-fluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl)acetamide |
| PubChem CID | 163371362 |
| Molecular Formula | C16H17FN2O2 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2-(6-cyclopropyl-2'-fluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl)acetamide |
| SMILES | NC(=O)CN1CC2(CC2F)c2cc(C3CC3)ccc2C1=O |
| InChI | InChI=1S/C16H17FN2O2/c17-13-6-16(13)8-19(7-14(18)20)15(21)11-4-3-10(5-12(11)16)9-1-2-9/h3-5,9,13H,1-2,6-8H2,(H2,18,20) |
| InChIKey | GSRAWZFDIHLSJM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(6-cyclopropyl-2'-fluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-cyclopropyl-2'-fluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl)acetamide?
The IUPAC name of 2-(6-cyclopropyl-2'-fluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl)acetamide (CID 163371362) is 2-(6-cyclopropyl-2'-fluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl)acetamide.
What is the SMILES notation for 2-(6-cyclopropyl-2'-fluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl)acetamide?
The canonical SMILES for 2-(6-cyclopropyl-2'-fluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl)acetamide is NC(=O)CN1CC2(CC2F)c2cc(C3CC3)ccc2C1=O.
What is the InChIKey of 2-(6-cyclopropyl-2'-fluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl)acetamide?
The InChIKey is GSRAWZFDIHLSJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FN2O2/c17-13-6-16(13)8-19(7-14(18)20)15(21)11-4-3-10(5-12(11)16)9-1-2-9/h3-5,9,13H,1-2,6-8H2,(H2,18,20).
What are the key properties of 2-(6-cyclopropyl-2'-fluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl)acetamide?
2-(6-cyclopropyl-2'-fluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl)acetamide has a molecular weight of 288.32 g/mol, XLogP of 1.48, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-cyclopropyl-2'-fluoro-1-oxospiro[3H-isoquinoline-4,1'-cyclopropane]-2-yl)acetamide is sourced from PubChem (CID 163371362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).