About 6-bromospiro[2,3-dihydroisoquinoline-4,3'-oxetane]-1-one
6-bromospiro[2,3-dihydroisoquinoline-4,3'-oxetane]-1-one (PubChem CID 163371704) has the molecular formula C11H10BrNO2
and a molecular weight of 268.11 g/mol. Its IUPAC name is 6-bromospiro[2,3-dihydroisoquinoline-4,3'-oxetane]-1-one.
Molecular Properties
| Compound Name | 6-bromospiro[2,3-dihydroisoquinoline-4,3'-oxetane]-1-one |
| PubChem CID | 163371704 |
| Molecular Formula | C11H10BrNO2 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 6-bromospiro[2,3-dihydroisoquinoline-4,3'-oxetane]-1-one |
| SMILES | O=C1NCC2(COC2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C11H10BrNO2/c12-7-1-2-8-9(3-7)11(5-15-6-11)4-13-10(8)14/h1-3H,4-6H2,(H,13,14) |
| InChIKey | MZMCBDKBRNRIGE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromospiro[2,3-dihydroisoquinoline-4,3'-oxetane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromospiro[2,3-dihydroisoquinoline-4,3'-oxetane]-1-one?
The IUPAC name of 6-bromospiro[2,3-dihydroisoquinoline-4,3'-oxetane]-1-one (CID 163371704) is 6-bromospiro[2,3-dihydroisoquinoline-4,3'-oxetane]-1-one.
What is the SMILES notation for 6-bromospiro[2,3-dihydroisoquinoline-4,3'-oxetane]-1-one?
The canonical SMILES for 6-bromospiro[2,3-dihydroisoquinoline-4,3'-oxetane]-1-one is O=C1NCC2(COC2)c2cc(Br)ccc21.
What is the InChIKey of 6-bromospiro[2,3-dihydroisoquinoline-4,3'-oxetane]-1-one?
The InChIKey is MZMCBDKBRNRIGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrNO2/c12-7-1-2-8-9(3-7)11(5-15-6-11)4-13-10(8)14/h1-3H,4-6H2,(H,13,14).
What are the key properties of 6-bromospiro[2,3-dihydroisoquinoline-4,3'-oxetane]-1-one?
6-bromospiro[2,3-dihydroisoquinoline-4,3'-oxetane]-1-one has a molecular weight of 268.11 g/mol, XLogP of 1.46, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromospiro[2,3-dihydroisoquinoline-4,3'-oxetane]-1-one is sourced from PubChem (CID 163371704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).