About 2-(6-bromo-4,4-dimethyl-1-oxo-3H-isoquinolin-2-yl)-N-(3-methylcyclobutyl)acetamide
2-(6-bromo-4,4-dimethyl-1-oxo-3H-isoquinolin-2-yl)-N-(3-methylcyclobutyl)acetamide (PubChem CID 163371781) has the molecular formula C18H23BrN2O2
and a molecular weight of 379.30 g/mol. Its IUPAC name is 2-(6-bromo-4,4-dimethyl-1-oxo-3H-isoquinolin-2-yl)-N-(3-methylcyclobutyl)acetamide.
Molecular Properties
| Compound Name | 2-(6-bromo-4,4-dimethyl-1-oxo-3H-isoquinolin-2-yl)-N-(3-methylcyclobutyl)acetamide |
| PubChem CID | 163371781 |
| Molecular Formula | C18H23BrN2O2 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 2-(6-bromo-4,4-dimethyl-1-oxo-3H-isoquinolin-2-yl)-N-(3-methylcyclobutyl)acetamide |
| SMILES | CC1CC(NC(=O)CN2CC(C)(C)c3cc(Br)ccc3C2=O)C1 |
| InChI | InChI=1S/C18H23BrN2O2/c1-11-6-13(7-11)20-16(22)9-21-10-18(2,3)15-8-12(19)4-5-14(15)17(21)23/h4-5,8,11,13H,6-7,9-10H2,1-3H3,(H,20,22) |
| InChIKey | SCOYYHVCDGBTJD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(6-bromo-4,4-dimethyl-1-oxo-3H-isoquinolin-2-yl)-N-(3-methylcyclobutyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-bromo-4,4-dimethyl-1-oxo-3H-isoquinolin-2-yl)-N-(3-methylcyclobutyl)acetamide?
The IUPAC name of 2-(6-bromo-4,4-dimethyl-1-oxo-3H-isoquinolin-2-yl)-N-(3-methylcyclobutyl)acetamide (CID 163371781) is 2-(6-bromo-4,4-dimethyl-1-oxo-3H-isoquinolin-2-yl)-N-(3-methylcyclobutyl)acetamide.
What is the SMILES notation for 2-(6-bromo-4,4-dimethyl-1-oxo-3H-isoquinolin-2-yl)-N-(3-methylcyclobutyl)acetamide?
The canonical SMILES for 2-(6-bromo-4,4-dimethyl-1-oxo-3H-isoquinolin-2-yl)-N-(3-methylcyclobutyl)acetamide is CC1CC(NC(=O)CN2CC(C)(C)c3cc(Br)ccc3C2=O)C1.
What is the InChIKey of 2-(6-bromo-4,4-dimethyl-1-oxo-3H-isoquinolin-2-yl)-N-(3-methylcyclobutyl)acetamide?
The InChIKey is SCOYYHVCDGBTJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23BrN2O2/c1-11-6-13(7-11)20-16(22)9-21-10-18(2,3)15-8-12(19)4-5-14(15)17(21)23/h4-5,8,11,13H,6-7,9-10H2,1-3H3,(H,20,22).
What are the key properties of 2-(6-bromo-4,4-dimethyl-1-oxo-3H-isoquinolin-2-yl)-N-(3-methylcyclobutyl)acetamide?
2-(6-bromo-4,4-dimethyl-1-oxo-3H-isoquinolin-2-yl)-N-(3-methylcyclobutyl)acetamide has a molecular weight of 379.30 g/mol, XLogP of 3.10, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-bromo-4,4-dimethyl-1-oxo-3H-isoquinolin-2-yl)-N-(3-methylcyclobutyl)acetamide is sourced from PubChem (CID 163371781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).