About [4-(ethylideneamino)-2,5-dimethylphenyl]-[5-(trifluoromethyl)indol-1-yl]methanone
[4-(ethylideneamino)-2,5-dimethylphenyl]-[5-(trifluoromethyl)indol-1-yl]methanone (PubChem CID 163372641) has the molecular formula C20H17F3N2O
and a molecular weight of 358.36 g/mol. Its IUPAC name is [4-(ethylideneamino)-2,5-dimethylphenyl]-[5-(trifluoromethyl)indol-1-yl]methanone.
Molecular Properties
| Compound Name | [4-(ethylideneamino)-2,5-dimethylphenyl]-[5-(trifluoromethyl)indol-1-yl]methanone |
| PubChem CID | 163372641 |
| Molecular Formula | C20H17F3N2O |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | [4-(ethylideneamino)-2,5-dimethylphenyl]-[5-(trifluoromethyl)indol-1-yl]methanone |
| SMILES | C/C=N/c1cc(C)c(C(=O)n2ccc3cc(C(F)(F)F)ccc32)cc1C |
| InChI | InChI=1S/C20H17F3N2O/c1-4-24-17-10-12(2)16(9-13(17)3)19(26)25-8-7-14-11-15(20(21,22)23)5-6-18(14)25/h4-11H,1-3H3/b24-4+ |
| InChIKey | NRLPVBWXSGHWBX-FZZGJVLGSA-N |
| XLogP | 5.69 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(ethylideneamino)-2,5-dimethylphenyl]-[5-(trifluoromethyl)indol-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(ethylideneamino)-2,5-dimethylphenyl]-[5-(trifluoromethyl)indol-1-yl]methanone?
The IUPAC name of [4-(ethylideneamino)-2,5-dimethylphenyl]-[5-(trifluoromethyl)indol-1-yl]methanone (CID 163372641) is [4-(ethylideneamino)-2,5-dimethylphenyl]-[5-(trifluoromethyl)indol-1-yl]methanone.
What is the SMILES notation for [4-(ethylideneamino)-2,5-dimethylphenyl]-[5-(trifluoromethyl)indol-1-yl]methanone?
The canonical SMILES for [4-(ethylideneamino)-2,5-dimethylphenyl]-[5-(trifluoromethyl)indol-1-yl]methanone is C/C=N/c1cc(C)c(C(=O)n2ccc3cc(C(F)(F)F)ccc32)cc1C.
What is the InChIKey of [4-(ethylideneamino)-2,5-dimethylphenyl]-[5-(trifluoromethyl)indol-1-yl]methanone?
The InChIKey is NRLPVBWXSGHWBX-FZZGJVLGSA-N. The full InChI is InChI=1S/C20H17F3N2O/c1-4-24-17-10-12(2)16(9-13(17)3)19(26)25-8-7-14-11-15(20(21,22)23)5-6-18(14)25/h4-11H,1-3H3/b24-4+.
What are the key properties of [4-(ethylideneamino)-2,5-dimethylphenyl]-[5-(trifluoromethyl)indol-1-yl]methanone?
[4-(ethylideneamino)-2,5-dimethylphenyl]-[5-(trifluoromethyl)indol-1-yl]methanone has a molecular weight of 358.36 g/mol, XLogP of 5.69, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(ethylideneamino)-2,5-dimethylphenyl]-[5-(trifluoromethyl)indol-1-yl]methanone is sourced from PubChem (CID 163372641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).