C17H25NO4 — CID 163373377
benzyl N-(1-cyclobutylpropan-2-yl)-N-methylcarbamate;formic acid (PubChem CID 163373377) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is benzyl N-(1-cyclobutylpropan-2-yl)-N-methylcarbamate;formic acid.
| Compound Name | benzyl N-(1-cyclobutylpropan-2-yl)-N-methylcarbamate;formic acid |
|---|---|
| PubChem CID | 163373377 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | benzyl N-(1-cyclobutylpropan-2-yl)-N-methylcarbamate;formic acid |
| SMILES | CC(CC1CCC1)N(C)C(=O)OCc1ccccc1.O=CO |
| InChI | InChI=1S/C16H23NO2.CH2O2/c1-13(11-14-9-6-10-14)17(2)16(18)19-12-15-7-4-3-5-8-15;2-1-3/h3-5,7-8,13-14H,6,9-12H2,1-2H3;1H,(H,2,3) |
| InChIKey | HCJOFGCORZCGSB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|