C17H18N4OS — CID 163374232
2-[(3S)-3-methyl-4-methylsulfanyl-4,8,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-12-yl]phenol (PubChem CID 163374232) has the molecular formula C17H18N4OS and a molecular weight of 326.43 g/mol. Its IUPAC name is 2-[(3S)-3-methyl-4-methylsulfanyl-4,8,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-12-yl]phenol.
| Compound Name | 2-[(3S)-3-methyl-4-methylsulfanyl-4,8,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-12-yl]phenol |
|---|---|
| PubChem CID | 163374232 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-[(3S)-3-methyl-4-methylsulfanyl-4,8,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-12-yl]phenol |
| SMILES | CSN1CCc2[nH]c3nnc(-c4ccccc4O)cc3c2[C@@H]1C |
| InChI | InChI=1S/C17H18N4OS/c1-10-16-12-9-14(11-5-3-4-6-15(11)22)19-20-17(12)18-13(16)7-8-21(10)23-2/h3-6,9-10,22H,7-8H2,1-2H3,(H,18,20)/t10-/m0/s1 |
| InChIKey | DKXFWBBFCGVGIE-JTQLQIEISA-N |
| XLogP | 3.53 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|