C25H34N6O — CID 163374772
N,N-dimethyl-1-(4'-piperazin-1-ylspiro[2,3-dihydro-1H-naphthalene-4,7'-5,6-dihydropyrano[2,3-d]pyrimidine]-2'-yl)azetidin-3-amine (PubChem CID 163374772) has the molecular formula C25H34N6O and a molecular weight of 434.59 g/mol. Its IUPAC name is N,N-dimethyl-1-(4'-piperazin-1-ylspiro[2,3-dihydro-1H-naphthalene-4,7'-5,6-dihydropyrano[2,3-d]pyrimidine]-2'-yl)azetidin-3-amine.
| Compound Name | N,N-dimethyl-1-(4'-piperazin-1-ylspiro[2,3-dihydro-1H-naphthalene-4,7'-5,6-dihydropyrano[2,3-d]pyrimidine]-2'-yl)azetidin-3-amine |
|---|---|
| PubChem CID | 163374772 |
| Molecular Formula | C25H34N6O |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | N,N-dimethyl-1-(4'-piperazin-1-ylspiro[2,3-dihydro-1H-naphthalene-4,7'-5,6-dihydropyrano[2,3-d]pyrimidine]-2'-yl)azetidin-3-amine |
| SMILES | CN(C)C1CN(c2nc3c(c(N4CCNCC4)n2)CCC2(CCCc4ccccc42)O3)C1 |
| InChI | InChI=1S/C25H34N6O/c1-29(2)19-16-31(17-19)24-27-22(30-14-12-26-13-15-30)20-9-11-25(32-23(20)28-24)10-5-7-18-6-3-4-8-21(18)25/h3-4,6,8,19,26H,5,7,9-17H2,1-2H3 |
| InChIKey | UFFSPJYLUCVHOZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |