C27H27ClFN5O3 — CID 163374851
N'-(2-chloro-4-hydroxyphenyl)-4-(cyclopentylamino)-6-(2-fluoro-4,5-dimethoxyphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163374851) has the molecular formula C27H27ClFN5O3 and a molecular weight of 524.00 g/mol. Its IUPAC name is N'-(2-chloro-4-hydroxyphenyl)-4-(cyclopentylamino)-6-(2-fluoro-4,5-dimethoxyphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | N'-(2-chloro-4-hydroxyphenyl)-4-(cyclopentylamino)-6-(2-fluoro-4,5-dimethoxyphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163374851 |
| Molecular Formula | C27H27ClFN5O3 |
| Molecular Weight | 524.00 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | N'-(2-chloro-4-hydroxyphenyl)-4-(cyclopentylamino)-6-(2-fluoro-4,5-dimethoxyphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | COc1cc(F)c(-c2cc3c(NC4CCCC4)c(/C(N)=N/c4ccc(O)cc4Cl)cnn3c2)cc1OC |
| InChI | InChI=1S/C27H27ClFN5O3/c1-36-24-11-18(21(29)12-25(24)37-2)15-9-23-26(32-16-5-3-4-6-16)19(13-31-34(23)14-15)27(30)33-22-8-7-17(35)10-20(22)28/h7-14,16,32,35H,3-6H2,1-2H3,(H2,30,33) |
| InChIKey | VWFUPNBCRZSFPQ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.00 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|