C30H33N7O2 — CID 163374858
N'-(4-aminophenyl)-4-[(5-hydroxy-2-adamantyl)amino]-6-(6-methoxy-3-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163374858) has the molecular formula C30H33N7O2 and a molecular weight of 523.64 g/mol. Its IUPAC name is N'-(4-aminophenyl)-4-[(5-hydroxy-2-adamantyl)amino]-6-(6-methoxy-3-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | N'-(4-aminophenyl)-4-[(5-hydroxy-2-adamantyl)amino]-6-(6-methoxy-3-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163374858 |
| Molecular Formula | C30H33N7O2 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | N'-(4-aminophenyl)-4-[(5-hydroxy-2-adamantyl)amino]-6-(6-methoxy-3-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | COc1ccc(-c2cc3c(NC4C5CC6CC4CC(O)(C6)C5)c(/C(N)=N\c4ccc(N)cc4)cnn3c2)cn1 |
| InChI | InChI=1S/C30H33N7O2/c1-39-26-7-2-18(14-33-26)21-10-25-28(36-27-19-8-17-9-20(27)13-30(38,11-17)12-19)24(15-34-37(25)16-21)29(32)35-23-5-3-22(31)4-6-23/h2-7,10,14-17,19-20,27,36,38H,8-9,11-13,31H2,1H3,(H2,32,35) |
| InChIKey | MVYVOWZZMJEUDS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 136.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|