C32H41FN6O2Si — CID 163374862
N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-6-(2-fluoro-6-methyl-3-pyridinyl)-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163374862) has the molecular formula C32H41FN6O2Si and a molecular weight of 588.80 g/mol. Its IUPAC name is N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-6-(2-fluoro-6-methyl-3-pyridinyl)-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-6-(2-fluoro-6-methyl-3-pyridinyl)-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163374862 |
| Molecular Formula | C32H41FN6O2Si |
| Molecular Weight | 588.80 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-6-(2-fluoro-6-methyl-3-pyridinyl)-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1cc(O[Si](C)(C)C(C)(C)C)ccc1/N=C(\N)c1cnn2cc(-c3ccc(C)nc3F)cc2c1N[C@H]1CCOC1 |
| InChI | InChI=1S/C32H41FN6O2Si/c1-8-21-15-24(41-42(6,7)32(3,4)5)10-12-27(21)38-31(34)26-17-35-39-18-22(25-11-9-20(2)36-30(25)33)16-28(39)29(26)37-23-13-14-40-19-23/h9-12,15-18,23,37H,8,13-14,19H2,1-7H3,(H2,34,38)/t23-/m0/s1 |
| InChIKey | MRWSHUVKXATOFP-QHCPKHFHSA-N |
| XLogP | 7.03 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.80 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|