C32H33ClFN9O — CID 163374877
N'-(2-chloro-5-fluorophenyl)-4-[[1-[(1E,3Z)-1,4-diamino-4-cyanobuta-1,3-dienyl]piperidin-4-yl]amino]-6-(4-methoxy-2-methylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163374877) has the molecular formula C32H33ClFN9O and a molecular weight of 614.13 g/mol. Its IUPAC name is N'-(2-chloro-5-fluorophenyl)-4-[[1-[(1E,3Z)-1,4-diamino-4-cyanobuta-1,3-dienyl]piperidin-4-yl]amino]-6-(4-methoxy-2-methylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | N'-(2-chloro-5-fluorophenyl)-4-[[1-[(1E,3Z)-1,4-diamino-4-cyanobuta-1,3-dienyl]piperidin-4-yl]amino]-6-(4-methoxy-2-methylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163374877 |
| Molecular Formula | C32H33ClFN9O |
| Molecular Weight | 614.13 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | N'-(2-chloro-5-fluorophenyl)-4-[[1-[(1E,3Z)-1,4-diamino-4-cyanobuta-1,3-dienyl]piperidin-4-yl]amino]-6-(4-methoxy-2-methylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | COc1ccc(-c2cc3c(NC4CCN(/C(N)=C/C=C(\N)C#N)CC4)c(/C(N)=N/c4cc(F)ccc4Cl)cnn3c2)c(C)c1 |
| InChI | InChI=1S/C32H33ClFN9O/c1-19-13-24(44-2)5-6-25(19)20-14-29-31(40-23-9-11-42(12-10-23)30(37)8-4-22(36)16-35)26(17-39-43(29)18-20)32(38)41-28-15-21(34)3-7-27(28)33/h3-8,13-15,17-18,23,40H,9-12,36-37H2,1-2H3,(H2,38,41)/b22-4-,30-8+ |
| InChIKey | UPIZFVRHBOUDST-HTFYCFSQSA-N |
| XLogP | 5.19 |
| TPSA | 156.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.13 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|