C30H30ClFN6O — CID 163374887
4-[(4-aminocyclohexyl)amino]-N'-(2-chloro-5-fluorophenyl)-6-(4-methoxy-2-prop-1-ynylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163374887) has the molecular formula C30H30ClFN6O and a molecular weight of 545.06 g/mol. Its IUPAC name is 4-[(4-aminocyclohexyl)amino]-N'-(2-chloro-5-fluorophenyl)-6-(4-methoxy-2-prop-1-ynylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | 4-[(4-aminocyclohexyl)amino]-N'-(2-chloro-5-fluorophenyl)-6-(4-methoxy-2-prop-1-ynylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163374887 |
| Molecular Formula | C30H30ClFN6O |
| Molecular Weight | 545.06 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | 4-[(4-aminocyclohexyl)amino]-N'-(2-chloro-5-fluorophenyl)-6-(4-methoxy-2-prop-1-ynylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CC#Cc1cc(OC)ccc1-c1cc2c(NC3CCC(N)CC3)c(/C(N)=N/c3cc(F)ccc3Cl)cnn2c1 |
| InChI | InChI=1S/C30H30ClFN6O/c1-3-4-18-13-23(39-2)10-11-24(18)19-14-28-29(36-22-8-6-21(33)7-9-22)25(16-35-38(28)17-19)30(34)37-27-15-20(32)5-12-26(27)31/h5,10-17,21-22,36H,6-9,33H2,1-2H3,(H2,34,37) |
| InChIKey | CJUIPWIPKMSBQT-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.06 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|