C33H40ClFN6O — CID 163374901
N'-(2-chloro-5-fluorophenyl)-6-(4-methoxy-2-methylphenyl)-4-[[4-(pentylamino)cyclohexyl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163374901) has the molecular formula C33H40ClFN6O and a molecular weight of 591.18 g/mol. Its IUPAC name is N'-(2-chloro-5-fluorophenyl)-6-(4-methoxy-2-methylphenyl)-4-[[4-(pentylamino)cyclohexyl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | N'-(2-chloro-5-fluorophenyl)-6-(4-methoxy-2-methylphenyl)-4-[[4-(pentylamino)cyclohexyl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163374901 |
| Molecular Formula | C33H40ClFN6O |
| Molecular Weight | 591.18 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | N'-(2-chloro-5-fluorophenyl)-6-(4-methoxy-2-methylphenyl)-4-[[4-(pentylamino)cyclohexyl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCCCCNC1CCC(Nc2c(/C(N)=N/c3cc(F)ccc3Cl)cnn3cc(-c4ccc(OC)cc4C)cc23)CC1 |
| InChI | InChI=1S/C33H40ClFN6O/c1-4-5-6-15-37-24-8-10-25(11-9-24)39-32-28(33(36)40-30-18-23(35)7-14-29(30)34)19-38-41-20-22(17-31(32)41)27-13-12-26(42-3)16-21(27)2/h7,12-14,16-20,24-25,37,39H,4-6,8-11,15H2,1-3H3,(H2,36,40) |
| InChIKey | FOLTZCCEAVJAMG-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 88.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.18 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|